英文互译镜像站

Methionine sulfoxide reductase

Last updated

Methionine sulfoxide reductase may refer to:

Methionine-S-oxide reductase (EC 1.8.4.5, methyl sulfoxide reductase I and II, acetylmethionine sulfoxide reductase, methionine sulfoxide reductase, L-methionine:oxidized-thioredoxin S-oxidoreductase) is an enzyme with systematic name L-methionine:thioredoxin-disulfide S-oxidoreductase. This enzyme catalyses the following chemical reaction

In enzymology, a L-methionine (S)-S-oxide reductase (EC 1.8.4.13) is an enzyme that catalyzes the chemical reaction

Related Research Articles

MSRB may refer to:

MSRA may stand for:

Methionine synthase protein-coding gene in the species Homo sapiens

Methionine synthase also known as MS, MeSe, MetH is responsible for the regeneration of methionine from homocysteine. In humans it is encoded by the MTR gene. Methionine synthase forms part of the S-adenosylmethionine (SAMe) biosynthesis and regeneration cycle. In animals this enzyme requires Vitamin B12 (cobalamin) as a cofactor, whereas the form found in plants is cobalamin-independent. Microorganisms express both cobalamin-dependent and cobalamin-independent forms.

In enzymology, a [methionine synthase] reductase (EC 1.16.1.8) is an enzyme that catalyzes the chemical reaction

In enzymology, a L-methionine (R)-S-oxide reductase (EC 1.8.4.14) is an enzyme that catalyzes the chemical reaction

In enzymology, a peptide-methionine (R)-S-oxide reductase (EC 1.8.4.12) is an enzyme that catalyzes the chemical reaction

MTRR (gene) protein-coding gene in the species Homo sapiens

Methionine synthase reductase also known as MSR is an enzyme that in humans is encoded by the MTRR gene.

MSRA (gene) protein-coding gene in the species Homo sapiens

Peptide methionine sulfoxide reductase (Msr) is a family of enzymes that in humans is encoded by the MSRA gene.

MSRB2 protein-coding gene in the species Homo sapiens

Methionine-R-sulfoxide reductase B2, mitochondrial is an enzyme that in humans is encoded by the MSRB2 gene. The MRSB2 enzyme catalyzes the reduction of methionine sulfoxide to methionine.

SEPX1 protein-coding gene in the species Homo sapiens

Methionine-R-sulfoxide reductase B1 is an enzyme that in humans is encoded by the SEPX1 gene.

Sulfur is metabolized by all organisms, from bacteria and archaea to plants and animals. Sulfur is reduced or oxidized by organisms in a variety of forms. The element is present in proteins, sulfate esters of polysaccharides, steroids, phenols, and sulfur-containing coenzymes.

Methionine sulfoxide chemical compound

Methionine sulfoxide is the organic compound with the formula CH3S(O)CH2CH2CH(NH2)CO2H. It is an amino acid that occurs naturally although it is formed post-translationally.

Acetylmethionine sulfoxide reductase may refer to:

L-methionine:oxidized-thioredoxin S-oxidoreductase may refer to:

Protein-methionine-S-oxide reductase is an enzyme with systematic name protein-L-methionine:thioredoxin-disulfide S-oxidoreductase. This enzyme catalyses the following chemical reaction

Peptide methionine sulfoxide reductase could stand for:

Peptide-methionine (S)-S-oxide reductase (EC 1.8.4.11, MsrA, methionine sulphoxide reductase A, methionine S-oxide reductase (S-form oxidizing), methionine sulfoxide reductase A, peptide methionine sulfoxide reductase) is an enzyme with systematic name peptide-L-methionine:thioredoxin-disulfide S-oxidoreductase (L-methionine (S)-S-oxide-forming). This enzyme catalyses the following chemical reaction

Dr. Herbert Weissbach is an American biochemist/molecular biologist.